C11H19N3O5S2 — CID 126833413
5-[(2-methoxy-3-methylbutyl)sulfonylamino]pyridine-2-sulfonamide (PubChem CID 126833413) has the molecular formula C11H19N3O5S2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 5-[(2-methoxy-3-methylbutyl)sulfonylamino]pyridine-2-sulfonamide.
| Compound Name | 5-[(2-methoxy-3-methylbutyl)sulfonylamino]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 126833413 |
| Molecular Formula | C11H19N3O5S2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 5-[(2-methoxy-3-methylbutyl)sulfonylamino]pyridine-2-sulfonamide |
| SMILES | COC(CS(=O)(=O)Nc1ccc(S(N)(=O)=O)nc1)C(C)C |
| InChI | InChI=1S/C11H19N3O5S2/c1-8(2)10(19-3)7-20(15,16)14-9-4-5-11(13-6-9)21(12,17)18/h4-6,8,10,14H,7H2,1-3H3,(H2,12,17,18) |
| InChIKey | PVLXALSWVJXEMQ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |