C17H32N2O5 — CID 126834324
1-[3-[bis(2-methoxyethyl)amino]azetidin-1-yl]-2-(oxolan-2-ylmethoxy)propan-1-one (PubChem CID 126834324) has the molecular formula C17H32N2O5 and a molecular weight of 344.45 g/mol. Its IUPAC name is 1-[3-[bis(2-methoxyethyl)amino]azetidin-1-yl]-2-(oxolan-2-ylmethoxy)propan-1-one.
| Compound Name | 1-[3-[bis(2-methoxyethyl)amino]azetidin-1-yl]-2-(oxolan-2-ylmethoxy)propan-1-one |
|---|---|
| PubChem CID | 126834324 |
| Molecular Formula | C17H32N2O5 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 1-[3-[bis(2-methoxyethyl)amino]azetidin-1-yl]-2-(oxolan-2-ylmethoxy)propan-1-one |
| SMILES | COCCN(CCOC)C1CN(C(=O)C(C)OCC2CCCO2)C1 |
| InChI | InChI=1S/C17H32N2O5/c1-14(24-13-16-5-4-8-23-16)17(20)19-11-15(12-19)18(6-9-21-2)7-10-22-3/h14-16H,4-13H2,1-3H3 |
| InChIKey | QYBBLMFCWGTDAX-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |