C13H14ClN5O — CID 126835800
2-chloro-N-[[1-(cyclopropylmethyl)triazol-4-yl]methyl]pyridine-3-carboxamide (PubChem CID 126835800) has the molecular formula C13H14ClN5O and a molecular weight of 291.74 g/mol. Its IUPAC name is 2-chloro-N-[[1-(cyclopropylmethyl)triazol-4-yl]methyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[[1-(cyclopropylmethyl)triazol-4-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126835800 |
| Molecular Formula | C13H14ClN5O |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-chloro-N-[[1-(cyclopropylmethyl)triazol-4-yl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1cn(CC2CC2)nn1)c1cccnc1Cl |
| InChI | InChI=1S/C13H14ClN5O/c14-12-11(2-1-5-15-12)13(20)16-6-10-8-19(18-17-10)7-9-3-4-9/h1-2,5,8-9H,3-4,6-7H2,(H,16,20) |
| InChIKey | FVGIBGUYADIJOH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|