C13H13N7O2 — CID 142460646
N-[[1-(oxiran-2-ylmethyl)triazol-4-yl]methyl]-2H-pyrazolo[3,4-b]pyridine-3-carboxamide (PubChem CID 142460646) has the molecular formula C13H13N7O2 and a molecular weight of 299.29 g/mol. Its IUPAC name is N-[[1-(oxiran-2-ylmethyl)triazol-4-yl]methyl]-2H-pyrazolo[3,4-b]pyridine-3-carboxamide.
| Compound Name | N-[[1-(oxiran-2-ylmethyl)triazol-4-yl]methyl]-2H-pyrazolo[3,4-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142460646 |
| Molecular Formula | C13H13N7O2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-[[1-(oxiran-2-ylmethyl)triazol-4-yl]methyl]-2H-pyrazolo[3,4-b]pyridine-3-carboxamide |
| SMILES | O=C(NCc1cn(CC2CO2)nn1)c1[nH]nc2ncccc12 |
| InChI | InChI=1S/C13H13N7O2/c21-13(11-10-2-1-3-14-12(10)18-17-11)15-4-8-5-20(19-16-8)6-9-7-22-9/h1-3,5,9H,4,6-7H2,(H,15,21)(H,14,17,18) |
| InChIKey | STZXZKKZFZRBJS-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|