C13H20F3NO3 — CID 126836491
ethyl 3-(2,4-dimethylpent-4-enoylamino)-4,4,4-trifluorobutanoate (PubChem CID 126836491) has the molecular formula C13H20F3NO3 and a molecular weight of 295.30 g/mol. Its IUPAC name is ethyl 3-(2,4-dimethylpent-4-enoylamino)-4,4,4-trifluorobutanoate.
| Compound Name | ethyl 3-(2,4-dimethylpent-4-enoylamino)-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 126836491 |
| Molecular Formula | C13H20F3NO3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | ethyl 3-(2,4-dimethylpent-4-enoylamino)-4,4,4-trifluorobutanoate |
| SMILES | C=C(C)CC(C)C(=O)NC(CC(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C13H20F3NO3/c1-5-20-11(18)7-10(13(14,15)16)17-12(19)9(4)6-8(2)3/h9-10H,2,5-7H2,1,3-4H3,(H,17,19) |
| InChIKey | AOLHAYIDLBLYHP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|