About 5-hydroxy-N-[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]-2-propylpentanamide
5-hydroxy-N-[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]-2-propylpentanamide (PubChem CID 126839318) has the molecular formula C18H26N2O4
and a molecular weight of 334.42 g/mol. Its IUPAC name is 5-hydroxy-N-[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]-2-propylpentanamide.
Molecular Properties
| Compound Name | 5-hydroxy-N-[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]-2-propylpentanamide |
| PubChem CID | 126839318 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 5-hydroxy-N-[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]-2-propylpentanamide |
| SMILES | CCCC(CCCO)C(=O)Nc1ccc(CN2CCOC2=O)cc1 |
| InChI | InChI=1S/C18H26N2O4/c1-2-4-15(5-3-11-21)17(22)19-16-8-6-14(7-9-16)13-20-10-12-24-18(20)23/h6-9,15,21H,2-5,10-13H2,1H3,(H,19,22) |
| InChIKey | GGTNNZIBBZVOFU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-hydroxy-N-[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]-2-propylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-N-[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]-2-propylpentanamide?
The IUPAC name of 5-hydroxy-N-[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]-2-propylpentanamide (CID 126839318) is 5-hydroxy-N-[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]-2-propylpentanamide.
What is the SMILES notation for 5-hydroxy-N-[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]-2-propylpentanamide?
The canonical SMILES for 5-hydroxy-N-[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]-2-propylpentanamide is CCCC(CCCO)C(=O)Nc1ccc(CN2CCOC2=O)cc1.
What is the InChIKey of 5-hydroxy-N-[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]-2-propylpentanamide?
The InChIKey is GGTNNZIBBZVOFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O4/c1-2-4-15(5-3-11-21)17(22)19-16-8-6-14(7-9-16)13-20-10-12-24-18(20)23/h6-9,15,21H,2-5,10-13H2,1H3,(H,19,22).
What are the key properties of 5-hydroxy-N-[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]-2-propylpentanamide?
5-hydroxy-N-[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]-2-propylpentanamide has a molecular weight of 334.42 g/mol, XLogP of 2.77, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-N-[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]-2-propylpentanamide is sourced from PubChem (CID 126839318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).