C10H12BNO4 — CID 131735840
[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]boronic acid (PubChem CID 131735840) has the molecular formula C10H12BNO4 and a molecular weight of 221.02 g/mol. Its IUPAC name is [4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]boronic acid.
| Compound Name | [4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 131735840 |
| Molecular Formula | C10H12BNO4 |
| Molecular Weight | 221.02 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | [4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]boronic acid |
| SMILES | O=C1OCCN1Cc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C10H12BNO4/c13-10-12(5-6-16-10)7-8-1-3-9(4-2-8)11(14)15/h1-4,14-15H,5-7H2 |
| InChIKey | RODUZJKXIMBHPB-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.02 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|