C16H17N5O3 — CID 126839708
ethyl 1-[2-[(3-cyanophenyl)carbamoylamino]ethyl]imidazole-4-carboxylate (PubChem CID 126839708) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is ethyl 1-[2-[(3-cyanophenyl)carbamoylamino]ethyl]imidazole-4-carboxylate.
| Compound Name | ethyl 1-[2-[(3-cyanophenyl)carbamoylamino]ethyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 126839708 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | ethyl 1-[2-[(3-cyanophenyl)carbamoylamino]ethyl]imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(CCNC(=O)Nc2cccc(C#N)c2)cn1 |
| InChI | InChI=1S/C16H17N5O3/c1-2-24-15(22)14-10-21(11-19-14)7-6-18-16(23)20-13-5-3-4-12(8-13)9-17/h3-5,8,10-11H,2,6-7H2,1H3,(H2,18,20,23) |
| InChIKey | XETHVGUXOAYSGF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |