C16H21N5O — CID 126840873
7,7-dimethyl-1-[(2-phenyltriazol-4-yl)methyl]-1,4-diazepan-5-one (PubChem CID 126840873) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is 7,7-dimethyl-1-[(2-phenyltriazol-4-yl)methyl]-1,4-diazepan-5-one.
| Compound Name | 7,7-dimethyl-1-[(2-phenyltriazol-4-yl)methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 126840873 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 7,7-dimethyl-1-[(2-phenyltriazol-4-yl)methyl]-1,4-diazepan-5-one |
| SMILES | CC1(C)CC(=O)NCCN1Cc1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H21N5O/c1-16(2)10-15(22)17-8-9-20(16)12-13-11-18-21(19-13)14-6-4-3-5-7-14/h3-7,11H,8-10,12H2,1-2H3,(H,17,22) |
| InChIKey | CEBHWFWZUWHLFT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |