C18H20N2O3S — CID 126841087
4-[1-(2,3-dihydro-1-benzofuran-7-ylsulfonyl)piperidin-3-yl]pyridine (PubChem CID 126841087) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is 4-[1-(2,3-dihydro-1-benzofuran-7-ylsulfonyl)piperidin-3-yl]pyridine.
| Compound Name | 4-[1-(2,3-dihydro-1-benzofuran-7-ylsulfonyl)piperidin-3-yl]pyridine |
|---|---|
| PubChem CID | 126841087 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 4-[1-(2,3-dihydro-1-benzofuran-7-ylsulfonyl)piperidin-3-yl]pyridine |
| SMILES | O=S(=O)(c1cccc2c1OCC2)N1CCCC(c2ccncc2)C1 |
| InChI | InChI=1S/C18H20N2O3S/c21-24(22,17-5-1-3-15-8-12-23-18(15)17)20-11-2-4-16(13-20)14-6-9-19-10-7-14/h1,3,5-7,9-10,16H,2,4,8,11-13H2 |
| InChIKey | ANPXTPZOIOOQRU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |