C14H11Br4N5O2 — CID 126842893
3-[1-[2-(4,5,6,7-tetrabromobenzimidazol-1-yl)ethyl]triazol-4-yl]propanoic acid (PubChem CID 126842893) has the molecular formula C14H11Br4N5O2 and a molecular weight of 600.89 g/mol. Its IUPAC name is 3-[1-[2-(4,5,6,7-tetrabromobenzimidazol-1-yl)ethyl]triazol-4-yl]propanoic acid.
| Compound Name | 3-[1-[2-(4,5,6,7-tetrabromobenzimidazol-1-yl)ethyl]triazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 126842893 |
| Molecular Formula | C14H11Br4N5O2 |
| Molecular Weight | 600.89 g/mol |
| Exact Mass | 596.76 |
| IUPAC Name | 3-[1-[2-(4,5,6,7-tetrabromobenzimidazol-1-yl)ethyl]triazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1cn(CCn2cnc3c(Br)c(Br)c(Br)c(Br)c32)nn1 |
| InChI | InChI=1S/C14H11Br4N5O2/c15-9-10(16)12(18)14-13(11(9)17)19-6-22(14)3-4-23-5-7(20-21-23)1-2-8(24)25/h5-6H,1-4H2,(H,24,25) |
| InChIKey | QEPHOVPYOGXZIV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.89 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|