About (4Z)-4-[(3,5-difluorophenyl)methylidene]azepane;hydrochloride
(4Z)-4-[(3,5-difluorophenyl)methylidene]azepane;hydrochloride (PubChem CID 126844668) has the molecular formula C13H16ClF2N
and a molecular weight of 259.73 g/mol. Its IUPAC name is (4Z)-4-[(3,5-difluorophenyl)methylidene]azepane;hydrochloride.
Molecular Properties
| Compound Name | (4Z)-4-[(3,5-difluorophenyl)methylidene]azepane;hydrochloride |
| PubChem CID | 126844668 |
| Molecular Formula | C13H16ClF2N |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | (4Z)-4-[(3,5-difluorophenyl)methylidene]azepane;hydrochloride |
| SMILES | Cl.Fc1cc(F)cc(/C=C2/CCCNCC2)c1 |
| InChI | InChI=1S/C13H15F2N.ClH/c14-12-7-11(8-13(15)9-12)6-10-2-1-4-16-5-3-10;/h6-9,16H,1-5H2;1H/b10-6-; |
| InChIKey | INZSDDZECYCWNP-OTUCAILMSA-N |
| XLogP | 3.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4Z)-4-[(3,5-difluorophenyl)methylidene]azepane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-[(3,5-difluorophenyl)methylidene]azepane;hydrochloride?
The IUPAC name of (4Z)-4-[(3,5-difluorophenyl)methylidene]azepane;hydrochloride (CID 126844668) is (4Z)-4-[(3,5-difluorophenyl)methylidene]azepane;hydrochloride.
What is the SMILES notation for (4Z)-4-[(3,5-difluorophenyl)methylidene]azepane;hydrochloride?
The canonical SMILES for (4Z)-4-[(3,5-difluorophenyl)methylidene]azepane;hydrochloride is Cl.Fc1cc(F)cc(/C=C2/CCCNCC2)c1.
What is the InChIKey of (4Z)-4-[(3,5-difluorophenyl)methylidene]azepane;hydrochloride?
The InChIKey is INZSDDZECYCWNP-OTUCAILMSA-N. The full InChI is InChI=1S/C13H15F2N.ClH/c14-12-7-11(8-13(15)9-12)6-10-2-1-4-16-5-3-10;/h6-9,16H,1-5H2;1H/b10-6-;.
What are the key properties of (4Z)-4-[(3,5-difluorophenyl)methylidene]azepane;hydrochloride?
(4Z)-4-[(3,5-difluorophenyl)methylidene]azepane;hydrochloride has a molecular weight of 259.73 g/mol, XLogP of 3.54, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-[(3,5-difluorophenyl)methylidene]azepane;hydrochloride is sourced from PubChem (CID 126844668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).