C10H20ClF2NO — CID 126845171
2-[(2,2-difluoro-3,3-dimethylcyclopropyl)methoxy]-N-ethylethanamine;hydrochloride (PubChem CID 126845171) has the molecular formula C10H20ClF2NO and a molecular weight of 243.72 g/mol. Its IUPAC name is 2-[(2,2-difluoro-3,3-dimethylcyclopropyl)methoxy]-N-ethylethanamine;hydrochloride.
| Compound Name | 2-[(2,2-difluoro-3,3-dimethylcyclopropyl)methoxy]-N-ethylethanamine;hydrochloride |
|---|---|
| PubChem CID | 126845171 |
| Molecular Formula | C10H20ClF2NO |
| Molecular Weight | 243.72 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 2-[(2,2-difluoro-3,3-dimethylcyclopropyl)methoxy]-N-ethylethanamine;hydrochloride |
| SMILES | CCNCCOCC1C(C)(C)C1(F)F.Cl |
| InChI | InChI=1S/C10H19F2NO.ClH/c1-4-13-5-6-14-7-8-9(2,3)10(8,11)12;/h8,13H,4-7H2,1-3H3;1H |
| InChIKey | UUWXAFIPGIUTKB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.72 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|