C25H56N4O4 — CID 143968135
N-ethyl-2-[5-[2-(ethylamino)ethoxy]-3,3-bis[2-[2-(ethylamino)ethoxy]ethyl]pentoxy]ethanamine (PubChem CID 143968135) has the molecular formula C25H56N4O4 and a molecular weight of 476.75 g/mol. Its IUPAC name is N-ethyl-2-[5-[2-(ethylamino)ethoxy]-3,3-bis[2-[2-(ethylamino)ethoxy]ethyl]pentoxy]ethanamine.
| Compound Name | N-ethyl-2-[5-[2-(ethylamino)ethoxy]-3,3-bis[2-[2-(ethylamino)ethoxy]ethyl]pentoxy]ethanamine |
|---|---|
| PubChem CID | 143968135 |
| Molecular Formula | C25H56N4O4 |
| Molecular Weight | 476.75 g/mol |
| Exact Mass | 476.43 |
| IUPAC Name | N-ethyl-2-[5-[2-(ethylamino)ethoxy]-3,3-bis[2-[2-(ethylamino)ethoxy]ethyl]pentoxy]ethanamine |
| SMILES | CCNCCOCCC(CCOCCNCC)(CCOCCNCC)CCOCCNCC |
| InChI | InChI=1S/C25H56N4O4/c1-5-26-13-21-30-17-9-25(10-18-31-22-14-27-6-2,11-19-32-23-15-28-7-3)12-20-33-24-16-29-8-4/h26-29H,5-24H2,1-4H3 |
| InChIKey | OJESNRQXWPYGSO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 85.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.75 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|