C11H17F2N — CID 126845454
1-cyclopentyl-2,2-difluoro-6-azaspiro[2.4]heptane (PubChem CID 126845454) has the molecular formula C11H17F2N and a molecular weight of 201.26 g/mol. Its IUPAC name is 1-cyclopentyl-2,2-difluoro-6-azaspiro[2.4]heptane.
| Compound Name | 1-cyclopentyl-2,2-difluoro-6-azaspiro[2.4]heptane |
|---|---|
| PubChem CID | 126845454 |
| Molecular Formula | C11H17F2N |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 1-cyclopentyl-2,2-difluoro-6-azaspiro[2.4]heptane |
| SMILES | FC1(F)C(C2CCCC2)C12CCNC2 |
| InChI | InChI=1S/C11H17F2N/c12-11(13)9(8-3-1-2-4-8)10(11)5-6-14-7-10/h8-9,14H,1-7H2 |
| InChIKey | PZYUTZCKKDIMFB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |