C12H19N3O2 — CID 126846494
trans-(1S,2S)-2-(2-pyrazin-2-yloxyethylamino)cyclohexan-1-ol (PubChem CID 126846494) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is trans-(1S,2S)-2-(2-pyrazin-2-yloxyethylamino)cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-(2-pyrazin-2-yloxyethylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 126846494 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | trans-(1S,2S)-2-(2-pyrazin-2-yloxyethylamino)cyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@@H]1NCCOc1cnccn1 |
| InChI | InChI=1S/C12H19N3O2/c16-11-4-2-1-3-10(11)14-7-8-17-12-9-13-5-6-15-12/h5-6,9-11,14,16H,1-4,7-8H2/t10-,11-/m0/s1 |
| InChIKey | NYCKVZHYJFHNSN-QWRGUYRKSA-N |
| XLogP | 0.75 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|