C11H24N2O3 — CID 126846959
4-[[2,2-dimethoxyethyl(methyl)amino]methyl]piperidin-4-ol (PubChem CID 126846959) has the molecular formula C11H24N2O3 and a molecular weight of 232.32 g/mol. Its IUPAC name is 4-[[2,2-dimethoxyethyl(methyl)amino]methyl]piperidin-4-ol.
| Compound Name | 4-[[2,2-dimethoxyethyl(methyl)amino]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 126846959 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 4-[[2,2-dimethoxyethyl(methyl)amino]methyl]piperidin-4-ol |
| SMILES | COC(CN(C)CC1(O)CCNCC1)OC |
| InChI | InChI=1S/C11H24N2O3/c1-13(8-10(15-2)16-3)9-11(14)4-6-12-7-5-11/h10,12,14H,4-9H2,1-3H3 |
| InChIKey | GIRUUNJOZZTLIH-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|