C10H22N2O — CID 126847057
(3R,4R)-4-[butyl(ethyl)amino]pyrrolidin-3-ol (PubChem CID 126847057) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is (3R,4R)-4-[butyl(ethyl)amino]pyrrolidin-3-ol.
| Compound Name | (3R,4R)-4-[butyl(ethyl)amino]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 126847057 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | (3R,4R)-4-[butyl(ethyl)amino]pyrrolidin-3-ol |
| SMILES | CCCCN(CC)[C@@H]1CNC[C@H]1O |
| InChI | InChI=1S/C10H22N2O/c1-3-5-6-12(4-2)9-7-11-8-10(9)13/h9-11,13H,3-8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | JSIIAKWEWOPNFY-NXEZZACHSA-N |
| XLogP | 0.44 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |