C29H62N4 — CID 23374298
3-N,3-N,4-N,4-N,5-N,5-N-hexabutylpiperidine-3,4,5-triamine (PubChem CID 23374298) has the molecular formula C29H62N4 and a molecular weight of 466.84 g/mol. Its IUPAC name is 3-N,3-N,4-N,4-N,5-N,5-N-hexabutylpiperidine-3,4,5-triamine.
| Compound Name | 3-N,3-N,4-N,4-N,5-N,5-N-hexabutylpiperidine-3,4,5-triamine |
|---|---|
| PubChem CID | 23374298 |
| Molecular Formula | C29H62N4 |
| Molecular Weight | 466.84 g/mol |
| Exact Mass | 466.50 |
| IUPAC Name | 3-N,3-N,4-N,4-N,5-N,5-N-hexabutylpiperidine-3,4,5-triamine |
| SMILES | CCCCN(CCCC)C1CNCC(N(CCCC)CCCC)C1N(CCCC)CCCC |
| InChI | InChI=1S/C29H62N4/c1-7-13-19-31(20-14-8-2)27-25-30-26-28(32(21-15-9-3)22-16-10-4)29(27)33(23-17-11-5)24-18-12-6/h27-30H,7-26H2,1-6H3 |
| InChIKey | HWYAFDVUBUTKSY-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.84 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |