C12H17FN2O — CID 126847066
(3R,4R)-4-[2-(4-fluorophenyl)ethylamino]pyrrolidin-3-ol (PubChem CID 126847066) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is (3R,4R)-4-[2-(4-fluorophenyl)ethylamino]pyrrolidin-3-ol.
| Compound Name | (3R,4R)-4-[2-(4-fluorophenyl)ethylamino]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 126847066 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | (3R,4R)-4-[2-(4-fluorophenyl)ethylamino]pyrrolidin-3-ol |
| SMILES | O[C@@H]1CNC[C@H]1NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C12H17FN2O/c13-10-3-1-9(2-4-10)5-6-15-11-7-14-8-12(11)16/h1-4,11-12,14-16H,5-8H2/t11-,12-/m1/s1 |
| InChIKey | LRVWRKBMGGKQIM-VXGBXAGGSA-N |
| XLogP | 0.29 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |