C9H17ClN2O — CID 126847364
2-methyl-2,9-diazaspiro[4.5]decan-3-one;hydrochloride (PubChem CID 126847364) has the molecular formula C9H17ClN2O and a molecular weight of 204.70 g/mol. Its IUPAC name is 2-methyl-2,9-diazaspiro[4.5]decan-3-one;hydrochloride.
| Compound Name | 2-methyl-2,9-diazaspiro[4.5]decan-3-one;hydrochloride |
|---|---|
| PubChem CID | 126847364 |
| Molecular Formula | C9H17ClN2O |
| Molecular Weight | 204.70 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-methyl-2,9-diazaspiro[4.5]decan-3-one;hydrochloride |
| SMILES | CN1CC2(CCCNC2)CC1=O.Cl |
| InChI | InChI=1S/C9H16N2O.ClH/c1-11-7-9(5-8(11)12)3-2-4-10-6-9;/h10H,2-7H2,1H3;1H |
| InChIKey | RRDJESWEHBBZPX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.70 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |