About 2-methyl-2,9-diazaspiro[4.5]decan-3-one;hydrochloride
2-methyl-2,9-diazaspiro[4.5]decan-3-one;hydrochloride (PubChem CID 126847364) has the molecular formula C9H17ClN2O
and a molecular weight of 204.70 g/mol. Its IUPAC name is 2-methyl-2,9-diazaspiro[4.5]decan-3-one;hydrochloride.
Molecular Properties
| Compound Name | 2-methyl-2,9-diazaspiro[4.5]decan-3-one;hydrochloride |
| PubChem CID | 126847364 |
| Molecular Formula | C9H17ClN2O |
| Molecular Weight | 204.70 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-methyl-2,9-diazaspiro[4.5]decan-3-one;hydrochloride |
| SMILES | CN1CC2(CCCNC2)CC1=O.Cl |
| InChI | InChI=1S/C9H16N2O.ClH/c1-11-7-9(5-8(11)12)3-2-4-10-6-9;/h10H,2-7H2,1H3;1H |
| InChIKey | RRDJESWEHBBZPX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.70 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-2,9-diazaspiro[4.5]decan-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,9-diazaspiro[4.5]decan-3-one;hydrochloride?
The IUPAC name of 2-methyl-2,9-diazaspiro[4.5]decan-3-one;hydrochloride (CID 126847364) is 2-methyl-2,9-diazaspiro[4.5]decan-3-one;hydrochloride.
What is the SMILES notation for 2-methyl-2,9-diazaspiro[4.5]decan-3-one;hydrochloride?
The canonical SMILES for 2-methyl-2,9-diazaspiro[4.5]decan-3-one;hydrochloride is CN1CC2(CCCNC2)CC1=O.Cl.
What is the InChIKey of 2-methyl-2,9-diazaspiro[4.5]decan-3-one;hydrochloride?
The InChIKey is RRDJESWEHBBZPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O.ClH/c1-11-7-9(5-8(11)12)3-2-4-10-6-9;/h10H,2-7H2,1H3;1H.
What are the key properties of 2-methyl-2,9-diazaspiro[4.5]decan-3-one;hydrochloride?
2-methyl-2,9-diazaspiro[4.5]decan-3-one;hydrochloride has a molecular weight of 204.70 g/mol, XLogP of 0.64, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,9-diazaspiro[4.5]decan-3-one;hydrochloride is sourced from PubChem (CID 126847364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).