C12H14OS — CID 126847481
cis-(1S,2R)-2-(2-thiophen-2-ylethynyl)cyclohexan-1-ol (PubChem CID 126847481) has the molecular formula C12H14OS and a molecular weight of 206.31 g/mol. Its IUPAC name is cis-(1S,2R)-2-(2-thiophen-2-ylethynyl)cyclohexan-1-ol.
| Compound Name | cis-(1S,2R)-2-(2-thiophen-2-ylethynyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 126847481 |
| Molecular Formula | C12H14OS |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | cis-(1S,2R)-2-(2-thiophen-2-ylethynyl)cyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@@H]1C#Cc1cccs1 |
| InChI | InChI=1S/C12H14OS/c13-12-6-2-1-4-10(12)7-8-11-5-3-9-14-11/h3,5,9-10,12-13H,1-2,4,6H2/t10-,12+/m1/s1 |
| InChIKey | SZBYYDDLVVDVQC-PWSUYJOCSA-N |
| XLogP | 2.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|