(3-fluorooxolan-3-yl)methanesulfonyl chloride

C5H8ClFO3S — CID 126849355

IUPAC(3-fluorooxolan-3-yl)methanesulfonyl chloride
SMILESO=S(=O)(Cl)CC1(F)CCOC1
InChIInChI=1S/C5H8ClFO3S/c6-11(8,9)4-5(7)1-2-10-3-5/h1-4H2
InChIKeyCPZPYAWOGIPACY-UHFFFAOYSA-N
MW202.63 g/mol
LogP0.68
Rot. Bonds2

About (3-fluorooxolan-3-yl)methanesulfonyl chloride

(3-fluorooxolan-3-yl)methanesulfonyl chloride (PubChem CID 126849355) has the molecular formula C5H8ClFO3S and a molecular weight of 202.63 g/mol. Its IUPAC name is (3-fluorooxolan-3-yl)methanesulfonyl chloride.

Molecular Properties

Compound Name(3-fluorooxolan-3-yl)methanesulfonyl chloride
PubChem CID126849355
Molecular FormulaC5H8ClFO3S
Molecular Weight202.63 g/mol
Exact Mass201.99
IUPAC Name(3-fluorooxolan-3-yl)methanesulfonyl chloride
SMILESO=S(=O)(Cl)CC1(F)CCOC1
InChIInChI=1S/C5H8ClFO3S/c6-11(8,9)4-5(7)1-2-10-3-5/h1-4H2
InChIKeyCPZPYAWOGIPACY-UHFFFAOYSA-N
XLogP0.68
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.63
LogP ≤ 50.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze (3-fluorooxolan-3-yl)methanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Oxolan-3-ylmethanesulfonyl chloride
CID 23000703
Oxolane-3-sulfonyl chloride
CID 49762850
3-Furanmethanesulfonyl fluoride, tetrahydro-
CID 50989451
(3R)-oxolane-3-sulfonyl chloride
CID 98050551
(3S)-Tetrahydro-3-furansulfonyl chloride
CID 98050552
(3-Methyloxolan-3-yl)methanesulfonyl chloride
CID 115021590
rac-(3R,4S)-4-fluorooxolane-3-sulfonyl chloride
CID 124709145
Methyl (3-fluorooxolan-3-yl)methanesulfonate
CID 175510043
[(3R)-oxolan-3-yl]methanesulfonyl fluoride
CID 98124118
[(3S)-oxolan-3-yl]methanesulfonyl fluoride
CID 98124119
2,2,2-Trifluoro-1-(oxolan-3-yl)ethanesulfonyl chloride
CID 114827580
4-Fluorooxolane-3-sulfonyl chloride
CID 119031868

Frequently Asked Questions

What is the IUPAC name of (3-fluorooxolan-3-yl)methanesulfonyl chloride?
The IUPAC name of (3-fluorooxolan-3-yl)methanesulfonyl chloride (CID 126849355) is (3-fluorooxolan-3-yl)methanesulfonyl chloride.
What is the SMILES notation for (3-fluorooxolan-3-yl)methanesulfonyl chloride?
The canonical SMILES for (3-fluorooxolan-3-yl)methanesulfonyl chloride is O=S(=O)(Cl)CC1(F)CCOC1.
What is the InChIKey of (3-fluorooxolan-3-yl)methanesulfonyl chloride?
The InChIKey is CPZPYAWOGIPACY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClFO3S/c6-11(8,9)4-5(7)1-2-10-3-5/h1-4H2.
What are the key properties of (3-fluorooxolan-3-yl)methanesulfonyl chloride?
(3-fluorooxolan-3-yl)methanesulfonyl chloride has a molecular weight of 202.63 g/mol, XLogP of 0.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorooxolan-3-yl)methanesulfonyl chloride is sourced from PubChem (CID 126849355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).