C17H26BrN3O3S — CID 126853012
3-(2-bromophenyl)-N-[[1-(dimethylsulfamoyl)piperidin-4-yl]methyl]propanamide (PubChem CID 126853012) has the molecular formula C17H26BrN3O3S and a molecular weight of 432.38 g/mol. Its IUPAC name is 3-(2-bromophenyl)-N-[[1-(dimethylsulfamoyl)piperidin-4-yl]methyl]propanamide.
| Compound Name | 3-(2-bromophenyl)-N-[[1-(dimethylsulfamoyl)piperidin-4-yl]methyl]propanamide |
|---|---|
| PubChem CID | 126853012 |
| Molecular Formula | C17H26BrN3O3S |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 3-(2-bromophenyl)-N-[[1-(dimethylsulfamoyl)piperidin-4-yl]methyl]propanamide |
| SMILES | CN(C)S(=O)(=O)N1CCC(CNC(=O)CCc2ccccc2Br)CC1 |
| InChI | InChI=1S/C17H26BrN3O3S/c1-20(2)25(23,24)21-11-9-14(10-12-21)13-19-17(22)8-7-15-5-3-4-6-16(15)18/h3-6,14H,7-13H2,1-2H3,(H,19,22) |
| InChIKey | MEBBYTFOKQVLLJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |