C20H22N4O5S — CID 126855625
4-(4-morpholin-4-ylsulfonylbenzoyl)-1-pyridin-3-ylpiperazin-2-one (PubChem CID 126855625) has the molecular formula C20H22N4O5S and a molecular weight of 430.49 g/mol. Its IUPAC name is 4-(4-morpholin-4-ylsulfonylbenzoyl)-1-pyridin-3-ylpiperazin-2-one.
| Compound Name | 4-(4-morpholin-4-ylsulfonylbenzoyl)-1-pyridin-3-ylpiperazin-2-one |
|---|---|
| PubChem CID | 126855625 |
| Molecular Formula | C20H22N4O5S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 4-(4-morpholin-4-ylsulfonylbenzoyl)-1-pyridin-3-ylpiperazin-2-one |
| SMILES | O=C(c1ccc(S(=O)(=O)N2CCOCC2)cc1)N1CCN(c2cccnc2)C(=O)C1 |
| InChI | InChI=1S/C20H22N4O5S/c25-19-15-22(8-9-24(19)17-2-1-7-21-14-17)20(26)16-3-5-18(6-4-16)30(27,28)23-10-12-29-13-11-23/h1-7,14H,8-13,15H2 |
| InChIKey | IBPKYAJKBNGSHC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 100.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |