C10H15FN2O2 — CID 126857076
2-fluoro-N-[(3-methyl-1,2-oxazol-5-yl)methyl]oxan-3-amine (PubChem CID 126857076) has the molecular formula C10H15FN2O2 and a molecular weight of 214.24 g/mol. Its IUPAC name is 2-fluoro-N-[(3-methyl-1,2-oxazol-5-yl)methyl]oxan-3-amine.
| Compound Name | 2-fluoro-N-[(3-methyl-1,2-oxazol-5-yl)methyl]oxan-3-amine |
|---|---|
| PubChem CID | 126857076 |
| Molecular Formula | C10H15FN2O2 |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2-fluoro-N-[(3-methyl-1,2-oxazol-5-yl)methyl]oxan-3-amine |
| SMILES | Cc1cc(CNC2CCCOC2F)on1 |
| InChI | InChI=1S/C10H15FN2O2/c1-7-5-8(15-13-7)6-12-9-3-2-4-14-10(9)11/h5,9-10,12H,2-4,6H2,1H3 |
| InChIKey | ASPFFAWHLSWIOZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |