About 6-tert-butyl-2-[[1-(2,5-dimethylpyrazole-3-carbonyl)piperidin-4-yl]methyl]pyridazin-3-one
6-tert-butyl-2-[[1-(2,5-dimethylpyrazole-3-carbonyl)piperidin-4-yl]methyl]pyridazin-3-one (PubChem CID 126862257) has the molecular formula C20H29N5O2
and a molecular weight of 371.49 g/mol. Its IUPAC name is 6-tert-butyl-2-[[1-(2,5-dimethylpyrazole-3-carbonyl)piperidin-4-yl]methyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 6-tert-butyl-2-[[1-(2,5-dimethylpyrazole-3-carbonyl)piperidin-4-yl]methyl]pyridazin-3-one |
| PubChem CID | 126862257 |
| Molecular Formula | C20H29N5O2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 6-tert-butyl-2-[[1-(2,5-dimethylpyrazole-3-carbonyl)piperidin-4-yl]methyl]pyridazin-3-one |
| SMILES | Cc1cc(C(=O)N2CCC(Cn3nc(C(C)(C)C)ccc3=O)CC2)n(C)n1 |
| InChI | InChI=1S/C20H29N5O2/c1-14-12-16(23(5)21-14)19(27)24-10-8-15(9-11-24)13-25-18(26)7-6-17(22-25)20(2,3)4/h6-7,12,15H,8-11,13H2,1-5H3 |
| InChIKey | JVLYIMKHCFZDNJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-tert-butyl-2-[[1-(2,5-dimethylpyrazole-3-carbonyl)piperidin-4-yl]methyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2-[[1-(2,5-dimethylpyrazole-3-carbonyl)piperidin-4-yl]methyl]pyridazin-3-one?
The IUPAC name of 6-tert-butyl-2-[[1-(2,5-dimethylpyrazole-3-carbonyl)piperidin-4-yl]methyl]pyridazin-3-one (CID 126862257) is 6-tert-butyl-2-[[1-(2,5-dimethylpyrazole-3-carbonyl)piperidin-4-yl]methyl]pyridazin-3-one.
What is the SMILES notation for 6-tert-butyl-2-[[1-(2,5-dimethylpyrazole-3-carbonyl)piperidin-4-yl]methyl]pyridazin-3-one?
The canonical SMILES for 6-tert-butyl-2-[[1-(2,5-dimethylpyrazole-3-carbonyl)piperidin-4-yl]methyl]pyridazin-3-one is Cc1cc(C(=O)N2CCC(Cn3nc(C(C)(C)C)ccc3=O)CC2)n(C)n1.
What is the InChIKey of 6-tert-butyl-2-[[1-(2,5-dimethylpyrazole-3-carbonyl)piperidin-4-yl]methyl]pyridazin-3-one?
The InChIKey is JVLYIMKHCFZDNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29N5O2/c1-14-12-16(23(5)21-14)19(27)24-10-8-15(9-11-24)13-25-18(26)7-6-17(22-25)20(2,3)4/h6-7,12,15H,8-11,13H2,1-5H3.
What are the key properties of 6-tert-butyl-2-[[1-(2,5-dimethylpyrazole-3-carbonyl)piperidin-4-yl]methyl]pyridazin-3-one?
6-tert-butyl-2-[[1-(2,5-dimethylpyrazole-3-carbonyl)piperidin-4-yl]methyl]pyridazin-3-one has a molecular weight of 371.49 g/mol, XLogP of 2.14, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2-[[1-(2,5-dimethylpyrazole-3-carbonyl)piperidin-4-yl]methyl]pyridazin-3-one is sourced from PubChem (CID 126862257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).