C19H27N5O2 — CID 126862284
6-tert-butyl-2-[[1-(2-methylpyrazole-3-carbonyl)piperidin-4-yl]methyl]pyridazin-3-one (PubChem CID 126862284) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 6-tert-butyl-2-[[1-(2-methylpyrazole-3-carbonyl)piperidin-4-yl]methyl]pyridazin-3-one.
| Compound Name | 6-tert-butyl-2-[[1-(2-methylpyrazole-3-carbonyl)piperidin-4-yl]methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 126862284 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 6-tert-butyl-2-[[1-(2-methylpyrazole-3-carbonyl)piperidin-4-yl]methyl]pyridazin-3-one |
| SMILES | Cn1nccc1C(=O)N1CCC(Cn2nc(C(C)(C)C)ccc2=O)CC1 |
| InChI | InChI=1S/C19H27N5O2/c1-19(2,3)16-5-6-17(25)24(21-16)13-14-8-11-23(12-9-14)18(26)15-7-10-20-22(15)4/h5-7,10,14H,8-9,11-13H2,1-4H3 |
| InChIKey | LXXXOGSOBLVBEU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |