C19H30N4O2 — CID 126862544
6-tert-butyl-2-[[1-[(5-oxopyrrolidin-3-yl)methyl]piperidin-4-yl]methyl]pyridazin-3-one (PubChem CID 126862544) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 6-tert-butyl-2-[[1-[(5-oxopyrrolidin-3-yl)methyl]piperidin-4-yl]methyl]pyridazin-3-one.
| Compound Name | 6-tert-butyl-2-[[1-[(5-oxopyrrolidin-3-yl)methyl]piperidin-4-yl]methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 126862544 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 6-tert-butyl-2-[[1-[(5-oxopyrrolidin-3-yl)methyl]piperidin-4-yl]methyl]pyridazin-3-one |
| SMILES | CC(C)(C)c1ccc(=O)n(CC2CCN(CC3CNC(=O)C3)CC2)n1 |
| InChI | InChI=1S/C19H30N4O2/c1-19(2,3)16-4-5-18(25)23(21-16)13-14-6-8-22(9-7-14)12-15-10-17(24)20-11-15/h4-5,14-15H,6-13H2,1-3H3,(H,20,24) |
| InChIKey | KYOAUEGEUUZDSZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |