C17H27N3O3 — CID 126864206
2-[[1-[(3-hydroxyoxan-3-yl)methyl]piperidin-4-yl]methyl]-6-methylpyridazin-3-one (PubChem CID 126864206) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-[[1-[(3-hydroxyoxan-3-yl)methyl]piperidin-4-yl]methyl]-6-methylpyridazin-3-one.
| Compound Name | 2-[[1-[(3-hydroxyoxan-3-yl)methyl]piperidin-4-yl]methyl]-6-methylpyridazin-3-one |
|---|---|
| PubChem CID | 126864206 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 2-[[1-[(3-hydroxyoxan-3-yl)methyl]piperidin-4-yl]methyl]-6-methylpyridazin-3-one |
| SMILES | Cc1ccc(=O)n(CC2CCN(CC3(O)CCCOC3)CC2)n1 |
| InChI | InChI=1S/C17H27N3O3/c1-14-3-4-16(21)20(18-14)11-15-5-8-19(9-6-15)12-17(22)7-2-10-23-13-17/h3-4,15,22H,2,5-13H2,1H3 |
| InChIKey | JQCDFVDTNBKGMK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |