C20H34N4O3 — CID 126914281
6-tert-butyl-2-[2-[4-[(3-hydroxyoxan-3-yl)methyl]piperazin-1-yl]ethyl]pyridazin-3-one (PubChem CID 126914281) has the molecular formula C20H34N4O3 and a molecular weight of 378.52 g/mol. Its IUPAC name is 6-tert-butyl-2-[2-[4-[(3-hydroxyoxan-3-yl)methyl]piperazin-1-yl]ethyl]pyridazin-3-one.
| Compound Name | 6-tert-butyl-2-[2-[4-[(3-hydroxyoxan-3-yl)methyl]piperazin-1-yl]ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 126914281 |
| Molecular Formula | C20H34N4O3 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 6-tert-butyl-2-[2-[4-[(3-hydroxyoxan-3-yl)methyl]piperazin-1-yl]ethyl]pyridazin-3-one |
| SMILES | CC(C)(C)c1ccc(=O)n(CCN2CCN(CC3(O)CCCOC3)CC2)n1 |
| InChI | InChI=1S/C20H34N4O3/c1-19(2,3)17-5-6-18(25)24(21-17)13-12-22-8-10-23(11-9-22)15-20(26)7-4-14-27-16-20/h5-6,26H,4,7-16H2,1-3H3 |
| InChIKey | NYLWGVRIRVYDAN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |