C17H27N3O2 — CID 126928028
6-tert-butyl-2-[[1-[(1-hydroxycyclobutyl)methyl]azetidin-3-yl]methyl]pyridazin-3-one (PubChem CID 126928028) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 6-tert-butyl-2-[[1-[(1-hydroxycyclobutyl)methyl]azetidin-3-yl]methyl]pyridazin-3-one.
| Compound Name | 6-tert-butyl-2-[[1-[(1-hydroxycyclobutyl)methyl]azetidin-3-yl]methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 126928028 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 6-tert-butyl-2-[[1-[(1-hydroxycyclobutyl)methyl]azetidin-3-yl]methyl]pyridazin-3-one |
| SMILES | CC(C)(C)c1ccc(=O)n(CC2CN(CC3(O)CCC3)C2)n1 |
| InChI | InChI=1S/C17H27N3O2/c1-16(2,3)14-5-6-15(21)20(18-14)11-13-9-19(10-13)12-17(22)7-4-8-17/h5-6,13,22H,4,7-12H2,1-3H3 |
| InChIKey | OFGBYQIIUGXRDJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |