C22H37N5O2 — CID 126914211
1-[2-[4-[2-(3-tert-butyl-6-oxopyridazin-1-yl)ethyl]piperazin-1-yl]ethyl]azepan-2-one (PubChem CID 126914211) has the molecular formula C22H37N5O2 and a molecular weight of 403.57 g/mol. Its IUPAC name is 1-[2-[4-[2-(3-tert-butyl-6-oxopyridazin-1-yl)ethyl]piperazin-1-yl]ethyl]azepan-2-one.
| Compound Name | 1-[2-[4-[2-(3-tert-butyl-6-oxopyridazin-1-yl)ethyl]piperazin-1-yl]ethyl]azepan-2-one |
|---|---|
| PubChem CID | 126914211 |
| Molecular Formula | C22H37N5O2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | 1-[2-[4-[2-(3-tert-butyl-6-oxopyridazin-1-yl)ethyl]piperazin-1-yl]ethyl]azepan-2-one |
| SMILES | CC(C)(C)c1ccc(=O)n(CCN2CCN(CCN3CCCCCC3=O)CC2)n1 |
| InChI | InChI=1S/C22H37N5O2/c1-22(2,3)19-8-9-21(29)27(23-19)18-16-25-13-11-24(12-14-25)15-17-26-10-6-4-5-7-20(26)28/h8-9H,4-7,10-18H2,1-3H3 |
| InChIKey | NPEPVCYWZNFJLM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |