C22H23N7O — CID 126864422
2-[[1-(4-methylphthalazin-1-yl)piperidin-4-yl]methyl]-6-pyrazol-1-ylpyridazin-3-one (PubChem CID 126864422) has the molecular formula C22H23N7O and a molecular weight of 401.47 g/mol. Its IUPAC name is 2-[[1-(4-methylphthalazin-1-yl)piperidin-4-yl]methyl]-6-pyrazol-1-ylpyridazin-3-one.
| Compound Name | 2-[[1-(4-methylphthalazin-1-yl)piperidin-4-yl]methyl]-6-pyrazol-1-ylpyridazin-3-one |
|---|---|
| PubChem CID | 126864422 |
| Molecular Formula | C22H23N7O |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-[[1-(4-methylphthalazin-1-yl)piperidin-4-yl]methyl]-6-pyrazol-1-ylpyridazin-3-one |
| SMILES | Cc1nnc(N2CCC(Cn3nc(-n4cccn4)ccc3=O)CC2)c2ccccc12 |
| InChI | InChI=1S/C22H23N7O/c1-16-18-5-2-3-6-19(18)22(25-24-16)27-13-9-17(10-14-27)15-29-21(30)8-7-20(26-29)28-12-4-11-23-28/h2-8,11-12,17H,9-10,13-15H2,1H3 |
| InChIKey | VZNNYIVMMYTRDV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |