About 2-[[1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl]methoxy]pyridine-3-carbonitrile
2-[[1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl]methoxy]pyridine-3-carbonitrile (PubChem CID 126873654) has the molecular formula C17H20N4O2
and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-[[1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl]methoxy]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-[[1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl]methoxy]pyridine-3-carbonitrile |
| PubChem CID | 126873654 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-[[1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl]methoxy]pyridine-3-carbonitrile |
| SMILES | Cc1oncc1CN1CCC(COc2ncccc2C#N)CC1 |
| InChI | InChI=1S/C17H20N4O2/c1-13-16(10-20-23-13)11-21-7-4-14(5-8-21)12-22-17-15(9-18)3-2-6-19-17/h2-3,6,10,14H,4-5,7-8,11-12H2,1H3 |
| InChIKey | NAWKRDOEMMUHTB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl]methoxy]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl]methoxy]pyridine-3-carbonitrile?
The IUPAC name of 2-[[1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl]methoxy]pyridine-3-carbonitrile (CID 126873654) is 2-[[1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl]methoxy]pyridine-3-carbonitrile.
What is the SMILES notation for 2-[[1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl]methoxy]pyridine-3-carbonitrile?
The canonical SMILES for 2-[[1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl]methoxy]pyridine-3-carbonitrile is Cc1oncc1CN1CCC(COc2ncccc2C#N)CC1.
What is the InChIKey of 2-[[1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl]methoxy]pyridine-3-carbonitrile?
The InChIKey is NAWKRDOEMMUHTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4O2/c1-13-16(10-20-23-13)11-21-7-4-14(5-8-21)12-22-17-15(9-18)3-2-6-19-17/h2-3,6,10,14H,4-5,7-8,11-12H2,1H3.
What are the key properties of 2-[[1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl]methoxy]pyridine-3-carbonitrile?
2-[[1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl]methoxy]pyridine-3-carbonitrile has a molecular weight of 312.37 g/mol, XLogP of 2.54, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl]methoxy]pyridine-3-carbonitrile is sourced from PubChem (CID 126873654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).