About 1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidine-4-carbonitrile
1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidine-4-carbonitrile (PubChem CID 121174314) has the molecular formula C11H15N3O
and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidine-4-carbonitrile.
Molecular Properties
| Compound Name | 1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidine-4-carbonitrile |
| PubChem CID | 121174314 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidine-4-carbonitrile |
| SMILES | Cc1oncc1CN1CCC(C#N)CC1 |
| InChI | InChI=1S/C11H15N3O/c1-9-11(7-13-15-9)8-14-4-2-10(6-12)3-5-14/h7,10H,2-5,8H2,1H3 |
| InChIKey | HWHUQVBKPRUKAX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 53.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidine-4-carbonitrile?
The IUPAC name of 1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidine-4-carbonitrile (CID 121174314) is 1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidine-4-carbonitrile.
What is the SMILES notation for 1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidine-4-carbonitrile?
The canonical SMILES for 1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidine-4-carbonitrile is Cc1oncc1CN1CCC(C#N)CC1.
What is the InChIKey of 1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidine-4-carbonitrile?
The InChIKey is HWHUQVBKPRUKAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O/c1-9-11(7-13-15-9)8-14-4-2-10(6-12)3-5-14/h7,10H,2-5,8H2,1H3.
What are the key properties of 1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidine-4-carbonitrile?
1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidine-4-carbonitrile has a molecular weight of 205.26 g/mol, XLogP of 1.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-methyl-1,2-oxazol-4-yl)methyl]piperidine-4-carbonitrile is sourced from PubChem (CID 121174314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).