C17H22N6O — CID 126888273
N-[1-(2-cyclopropylpyrimidin-4-yl)piperidin-4-yl]-6-methoxypyrimidin-4-amine (PubChem CID 126888273) has the molecular formula C17H22N6O and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[1-(2-cyclopropylpyrimidin-4-yl)piperidin-4-yl]-6-methoxypyrimidin-4-amine.
| Compound Name | N-[1-(2-cyclopropylpyrimidin-4-yl)piperidin-4-yl]-6-methoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 126888273 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | N-[1-(2-cyclopropylpyrimidin-4-yl)piperidin-4-yl]-6-methoxypyrimidin-4-amine |
| SMILES | COc1cc(NC2CCN(c3ccnc(C4CC4)n3)CC2)ncn1 |
| InChI | InChI=1S/C17H22N6O/c1-24-16-10-14(19-11-20-16)21-13-5-8-23(9-6-13)15-4-7-18-17(22-15)12-2-3-12/h4,7,10-13H,2-3,5-6,8-9H2,1H3,(H,19,20,21) |
| InChIKey | BTVULEJOHDONPM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 76.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |