C16H20N6O — CID 171995695
N-[1-(2-cyclopropylpyrimidin-4-yl)pyrrolidin-3-yl]-4-methoxypyrimidin-2-amine (PubChem CID 171995695) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is N-[1-(2-cyclopropylpyrimidin-4-yl)pyrrolidin-3-yl]-4-methoxypyrimidin-2-amine.
| Compound Name | N-[1-(2-cyclopropylpyrimidin-4-yl)pyrrolidin-3-yl]-4-methoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 171995695 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | N-[1-(2-cyclopropylpyrimidin-4-yl)pyrrolidin-3-yl]-4-methoxypyrimidin-2-amine |
| SMILES | COc1ccnc(NC2CCN(c3ccnc(C4CC4)n3)C2)n1 |
| InChI | InChI=1S/C16H20N6O/c1-23-14-5-8-18-16(21-14)19-12-6-9-22(10-12)13-4-7-17-15(20-13)11-2-3-11/h4-5,7-8,11-12H,2-3,6,9-10H2,1H3,(H,18,19,21) |
| InChIKey | RKWBANPGEBLZCJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 76.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |