C14H17FN6O — CID 172891189
N-[1-(5-fluoro-6-methylpyrimidin-4-yl)pyrrolidin-3-yl]-4-methoxypyrimidin-2-amine (PubChem CID 172891189) has the molecular formula C14H17FN6O and a molecular weight of 304.33 g/mol. Its IUPAC name is N-[1-(5-fluoro-6-methylpyrimidin-4-yl)pyrrolidin-3-yl]-4-methoxypyrimidin-2-amine.
| Compound Name | N-[1-(5-fluoro-6-methylpyrimidin-4-yl)pyrrolidin-3-yl]-4-methoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 172891189 |
| Molecular Formula | C14H17FN6O |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[1-(5-fluoro-6-methylpyrimidin-4-yl)pyrrolidin-3-yl]-4-methoxypyrimidin-2-amine |
| SMILES | COc1ccnc(NC2CCN(c3ncnc(C)c3F)C2)n1 |
| InChI | InChI=1S/C14H17FN6O/c1-9-12(15)13(18-8-17-9)21-6-4-10(7-21)19-14-16-5-3-11(20-14)22-2/h3,5,8,10H,4,6-7H2,1-2H3,(H,16,19,20) |
| InChIKey | RJKUUSSLCNLOPM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 76.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |