C17H22N4OS — CID 126889193
[4-[methyl-(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]-(4-methylthiophen-2-yl)methanone (PubChem CID 126889193) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is [4-[methyl-(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]-(4-methylthiophen-2-yl)methanone.
| Compound Name | [4-[methyl-(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]-(4-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 126889193 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | [4-[methyl-(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]-(4-methylthiophen-2-yl)methanone |
| SMILES | Cc1csc(C(=O)N2CCC(N(C)c3cc(C)ncn3)CC2)c1 |
| InChI | InChI=1S/C17H22N4OS/c1-12-8-15(23-10-12)17(22)21-6-4-14(5-7-21)20(3)16-9-13(2)18-11-19-16/h8-11,14H,4-7H2,1-3H3 |
| InChIKey | AHELZTROXGHEPR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |