C11H15NO3S2 — CID 97414872
[(3R)-3-methylsulfonylpyrrolidin-1-yl]-(4-methylthiophen-2-yl)methanone (PubChem CID 97414872) has the molecular formula C11H15NO3S2 and a molecular weight of 273.38 g/mol. Its IUPAC name is [(3R)-3-methylsulfonylpyrrolidin-1-yl]-(4-methylthiophen-2-yl)methanone.
| Compound Name | [(3R)-3-methylsulfonylpyrrolidin-1-yl]-(4-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 97414872 |
| Molecular Formula | C11H15NO3S2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | [(3R)-3-methylsulfonylpyrrolidin-1-yl]-(4-methylthiophen-2-yl)methanone |
| SMILES | Cc1csc(C(=O)N2CC[C@@H](S(C)(=O)=O)C2)c1 |
| InChI | InChI=1S/C11H15NO3S2/c1-8-5-10(16-7-8)11(13)12-4-3-9(6-12)17(2,14)15/h5,7,9H,3-4,6H2,1-2H3/t9-/m1/s1 |
| InChIKey | JUTNFFWWIHGGJW-SECBINFHSA-N |
| XLogP | 1.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |