C10H12ClNO3S2 — CID 71805511
(5-chlorothiophen-2-yl)-(3-methylsulfonylpyrrolidin-1-yl)methanone (PubChem CID 71805511) has the molecular formula C10H12ClNO3S2 and a molecular weight of 293.80 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)-(3-methylsulfonylpyrrolidin-1-yl)methanone.
| Compound Name | (5-chlorothiophen-2-yl)-(3-methylsulfonylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 71805511 |
| Molecular Formula | C10H12ClNO3S2 |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | (5-chlorothiophen-2-yl)-(3-methylsulfonylpyrrolidin-1-yl)methanone |
| SMILES | CS(=O)(=O)C1CCN(C(=O)c2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C10H12ClNO3S2/c1-17(14,15)7-4-5-12(6-7)10(13)8-2-3-9(11)16-8/h2-3,7H,4-6H2,1H3 |
| InChIKey | LJQFNKVOIQXIHN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |