C17H28N4O2 — CID 126889548
3-[[4-[methyl-(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]methyl]oxan-3-ol (PubChem CID 126889548) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-[[4-[methyl-(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]methyl]oxan-3-ol.
| Compound Name | 3-[[4-[methyl-(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]methyl]oxan-3-ol |
|---|---|
| PubChem CID | 126889548 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 3-[[4-[methyl-(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]methyl]oxan-3-ol |
| SMILES | Cc1cc(N(C)C2CCN(CC3(O)CCCOC3)CC2)ncn1 |
| InChI | InChI=1S/C17H28N4O2/c1-14-10-16(19-13-18-14)20(2)15-4-7-21(8-5-15)11-17(22)6-3-9-23-12-17/h10,13,15,22H,3-9,11-12H2,1-2H3 |
| InChIKey | XTGCUEKGJZASPP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |