C14H18F3N5O — CID 126889834
3-[4-[[6-(trifluoromethyl)pyrimidin-4-yl]amino]piperidin-1-yl]pyrrolidin-2-one (PubChem CID 126889834) has the molecular formula C14H18F3N5O and a molecular weight of 329.33 g/mol. Its IUPAC name is 3-[4-[[6-(trifluoromethyl)pyrimidin-4-yl]amino]piperidin-1-yl]pyrrolidin-2-one.
| Compound Name | 3-[4-[[6-(trifluoromethyl)pyrimidin-4-yl]amino]piperidin-1-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 126889834 |
| Molecular Formula | C14H18F3N5O |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 3-[4-[[6-(trifluoromethyl)pyrimidin-4-yl]amino]piperidin-1-yl]pyrrolidin-2-one |
| SMILES | O=C1NCCC1N1CCC(Nc2cc(C(F)(F)F)ncn2)CC1 |
| InChI | InChI=1S/C14H18F3N5O/c15-14(16,17)11-7-12(20-8-19-11)21-9-2-5-22(6-3-9)10-1-4-18-13(10)23/h7-10H,1-6H2,(H,18,23)(H,19,20,21) |
| InChIKey | XNLFVVZEZCCGLR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |