C15H20F3N5O2 — CID 126889828
6-[[4-[[6-(trifluoromethyl)pyrimidin-4-yl]amino]piperidin-1-yl]methyl]morpholin-3-one (PubChem CID 126889828) has the molecular formula C15H20F3N5O2 and a molecular weight of 359.35 g/mol. Its IUPAC name is 6-[[4-[[6-(trifluoromethyl)pyrimidin-4-yl]amino]piperidin-1-yl]methyl]morpholin-3-one.
| Compound Name | 6-[[4-[[6-(trifluoromethyl)pyrimidin-4-yl]amino]piperidin-1-yl]methyl]morpholin-3-one |
|---|---|
| PubChem CID | 126889828 |
| Molecular Formula | C15H20F3N5O2 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 6-[[4-[[6-(trifluoromethyl)pyrimidin-4-yl]amino]piperidin-1-yl]methyl]morpholin-3-one |
| SMILES | O=C1COC(CN2CCC(Nc3cc(C(F)(F)F)ncn3)CC2)CN1 |
| InChI | InChI=1S/C15H20F3N5O2/c16-15(17,18)12-5-13(21-9-20-12)22-10-1-3-23(4-2-10)7-11-6-19-14(24)8-25-11/h5,9-11H,1-4,6-8H2,(H,19,24)(H,20,21,22) |
| InChIKey | YJYDKFBPALMLQP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |