C20H31N5O — CID 126890673
1-[2-[4-[cyclopropyl-(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]ethyl]piperidin-2-one (PubChem CID 126890673) has the molecular formula C20H31N5O and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-[2-[4-[cyclopropyl-(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]ethyl]piperidin-2-one.
| Compound Name | 1-[2-[4-[cyclopropyl-(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]ethyl]piperidin-2-one |
|---|---|
| PubChem CID | 126890673 |
| Molecular Formula | C20H31N5O |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | 1-[2-[4-[cyclopropyl-(6-methylpyrimidin-4-yl)amino]piperidin-1-yl]ethyl]piperidin-2-one |
| SMILES | Cc1cc(N(C2CC2)C2CCN(CCN3CCCCC3=O)CC2)ncn1 |
| InChI | InChI=1S/C20H31N5O/c1-16-14-19(22-15-21-16)25(17-5-6-17)18-7-10-23(11-8-18)12-13-24-9-3-2-4-20(24)26/h14-15,17-18H,2-13H2,1H3 |
| InChIKey | WBROHPDCOJKYOX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |