C21H22FN5 — CID 126892995
1-[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]phthalazine (PubChem CID 126892995) has the molecular formula C21H22FN5 and a molecular weight of 363.44 g/mol. Its IUPAC name is 1-[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]phthalazine.
| Compound Name | 1-[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]phthalazine |
|---|---|
| PubChem CID | 126892995 |
| Molecular Formula | C21H22FN5 |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 1-[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]phthalazine |
| SMILES | Fc1ccc(N2CCN(C3CN(c4nncc5ccccc45)C3)CC2)cc1 |
| InChI | InChI=1S/C21H22FN5/c22-17-5-7-18(8-6-17)25-9-11-26(12-10-25)19-14-27(15-19)21-20-4-2-1-3-16(20)13-23-24-21/h1-8,13,19H,9-12,14-15H2 |
| InChIKey | PVKUAPHNBCFNMP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |