About 3-[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]-1,2-benzothiazole 1,1-dioxide
3-[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]-1,2-benzothiazole 1,1-dioxide (PubChem CID 126892957) has the molecular formula C20H21FN4O2S
and a molecular weight of 400.48 g/mol. Its IUPAC name is 3-[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]-1,2-benzothiazole 1,1-dioxide.
Molecular Properties
| Compound Name | 3-[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]-1,2-benzothiazole 1,1-dioxide |
| PubChem CID | 126892957 |
| Molecular Formula | C20H21FN4O2S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 3-[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]-1,2-benzothiazole 1,1-dioxide |
| SMILES | O=S1(=O)N=C(N2CC(N3CCN(c4ccc(F)cc4)CC3)C2)c2ccccc21 |
| InChI | InChI=1S/C20H21FN4O2S/c21-15-5-7-16(8-6-15)23-9-11-24(12-10-23)17-13-25(14-17)20-18-3-1-2-4-19(18)28(26,27)22-20/h1-8,17H,9-14H2 |
| InChIKey | HYVOTJRNXYMSKG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]-1,2-benzothiazole 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]-1,2-benzothiazole 1,1-dioxide?
The IUPAC name of 3-[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]-1,2-benzothiazole 1,1-dioxide (CID 126892957) is 3-[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]-1,2-benzothiazole 1,1-dioxide.
What is the SMILES notation for 3-[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]-1,2-benzothiazole 1,1-dioxide?
The canonical SMILES for 3-[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]-1,2-benzothiazole 1,1-dioxide is O=S1(=O)N=C(N2CC(N3CCN(c4ccc(F)cc4)CC3)C2)c2ccccc21.
What is the InChIKey of 3-[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]-1,2-benzothiazole 1,1-dioxide?
The InChIKey is HYVOTJRNXYMSKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21FN4O2S/c21-15-5-7-16(8-6-15)23-9-11-24(12-10-23)17-13-25(14-17)20-18-3-1-2-4-19(18)28(26,27)22-20/h1-8,17H,9-14H2.
What are the key properties of 3-[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]-1,2-benzothiazole 1,1-dioxide?
3-[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]-1,2-benzothiazole 1,1-dioxide has a molecular weight of 400.48 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[4-(4-fluorophenyl)piperazin-1-yl]azetidin-1-yl]-1,2-benzothiazole 1,1-dioxide is sourced from PubChem (CID 126892957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).