C18H24FN5 — CID 126893111
1-(4-fluorophenyl)-4-[1-[(5-methyl-1H-pyrazol-3-yl)methyl]azetidin-3-yl]piperazine (PubChem CID 126893111) has the molecular formula C18H24FN5 and a molecular weight of 329.42 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[1-[(5-methyl-1H-pyrazol-3-yl)methyl]azetidin-3-yl]piperazine.
| Compound Name | 1-(4-fluorophenyl)-4-[1-[(5-methyl-1H-pyrazol-3-yl)methyl]azetidin-3-yl]piperazine |
|---|---|
| PubChem CID | 126893111 |
| Molecular Formula | C18H24FN5 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[1-[(5-methyl-1H-pyrazol-3-yl)methyl]azetidin-3-yl]piperazine |
| SMILES | Cc1cc(CN2CC(N3CCN(c4ccc(F)cc4)CC3)C2)n[nH]1 |
| InChI | InChI=1S/C18H24FN5/c1-14-10-16(21-20-14)11-22-12-18(13-22)24-8-6-23(7-9-24)17-4-2-15(19)3-5-17/h2-5,10,18H,6-9,11-13H2,1H3,(H,20,21) |
| InChIKey | QBSXSMFOQKBJCK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |