C21H28FN3O — CID 45167770
1-(4-fluorophenyl)-4-[1-[(5-methylfuran-2-yl)methyl]piperidin-3-yl]piperazine (PubChem CID 45167770) has the molecular formula C21H28FN3O and a molecular weight of 357.47 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[1-[(5-methylfuran-2-yl)methyl]piperidin-3-yl]piperazine.
| Compound Name | 1-(4-fluorophenyl)-4-[1-[(5-methylfuran-2-yl)methyl]piperidin-3-yl]piperazine |
|---|---|
| PubChem CID | 45167770 |
| Molecular Formula | C21H28FN3O |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[1-[(5-methylfuran-2-yl)methyl]piperidin-3-yl]piperazine |
| SMILES | Cc1ccc(CN2CCCC(N3CCN(c4ccc(F)cc4)CC3)C2)o1 |
| InChI | InChI=1S/C21H28FN3O/c1-17-4-9-21(26-17)16-23-10-2-3-20(15-23)25-13-11-24(12-14-25)19-7-5-18(22)6-8-19/h4-9,20H,2-3,10-16H2,1H3 |
| InChIKey | GRXLHLPILQGVCQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 22.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |